C28H36FN5O2 — CID 170092849
(5-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-[2-fluoro-4-methyl-5-(8-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl)anilino]methanol (PubChem CID 170092849) has the molecular formula C28H36FN5O2 and a molecular weight of 493.63 g/mol. Its IUPAC name is (5-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-[2-fluoro-4-methyl-5-(8-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl)anilino]methanol.
| Compound Name | (5-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-[2-fluoro-4-methyl-5-(8-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl)anilino]methanol |
|---|---|
| PubChem CID | 170092849 |
| Molecular Formula | C28H36FN5O2 |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (5-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-[2-fluoro-4-methyl-5-(8-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl)anilino]methanol |
| SMILES | Cc1cc(F)c(NC(O)N2CCC=C(C(C)(C)C)C2)cc1-c1cc(N2CCOCC2)c2nccn2c1 |
| InChI | InChI=1S/C28H36FN5O2/c1-19-14-23(29)24(31-27(35)34-8-5-6-21(18-34)28(2,3)4)16-22(19)20-15-25(32-10-12-36-13-11-32)26-30-7-9-33(26)17-20/h6-7,9,14-17,27,31,35H,5,8,10-13,18H2,1-4H3 |
| InChIKey | HFKRRKSOTLRERN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|