About 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine
1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine (PubChem CID 170092929) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine.
Molecular Properties
| Compound Name | 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine |
| PubChem CID | 170092929 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine |
| SMILES | CC1C=CC(OC2CN(C)C2)=CC1 |
| InChI | InChI=1S/C11H17NO/c1-9-3-5-10(6-4-9)13-11-7-12(2)8-11/h3,5-6,9,11H,4,7-8H2,1-2H3 |
| InChIKey | FBZWIUPLBYCUQW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine?
The IUPAC name of 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine (CID 170092929) is 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine.
What is the SMILES notation for 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine?
The canonical SMILES for 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine is CC1C=CC(OC2CN(C)C2)=CC1.
What is the InChIKey of 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine?
The InChIKey is FBZWIUPLBYCUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-9-3-5-10(6-4-9)13-11-7-12(2)8-11/h3,5-6,9,11H,4,7-8H2,1-2H3.
What are the key properties of 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine?
1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine has a molecular weight of 179.26 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(4-methylcyclohexa-1,5-dien-1-yl)oxyazetidine is sourced from PubChem (CID 170092929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).