C12H9F6N3O — CID 170093003
1-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone (PubChem CID 170093003) has the molecular formula C12H9F6N3O and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone.
| Compound Name | 1-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 170093003 |
| Molecular Formula | C12H9F6N3O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone |
| SMILES | CC(=O)c1nn(CCC(F)(F)C(F)(F)F)c2ncc(F)cc12 |
| InChI | InChI=1S/C12H9F6N3O/c1-6(22)9-8-4-7(13)5-19-10(8)21(20-9)3-2-11(14,15)12(16,17)18/h4-5H,2-3H2,1H3 |
| InChIKey | AVADMUNVDMETNP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|