C10H10N4O2 — CID 170093545
1-methyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,10-dione (PubChem CID 170093545) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-methyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,10-dione.
| Compound Name | 1-methyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,10-dione |
|---|---|
| PubChem CID | 170093545 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-methyl-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,10-dione |
| SMILES | CC12CCC(=O)Nc3ncnc(c31)NC2=O |
| InChI | InChI=1S/C10H10N4O2/c1-10-3-2-5(15)13-7-6(10)8(12-4-11-7)14-9(10)16/h4H,2-3H2,1H3,(H2,11,12,13,14,15,16) |
| InChIKey | KNRNMGXQHOWXCH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |