C26H26BrN3O2 — CID 17009369
4-bromo-N-[1-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17009369) has the molecular formula C26H26BrN3O2 and a molecular weight of 492.42 g/mol. Its IUPAC name is 4-bromo-N-[1-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[1-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17009369 |
| Molecular Formula | C26H26BrN3O2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 4-bromo-N-[1-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CCc1ccc(OCCn2c(C(C)NC(=O)c3ccc(Br)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H26BrN3O2/c1-3-19-8-14-22(15-9-19)32-17-16-30-24-7-5-4-6-23(24)29-25(30)18(2)28-26(31)20-10-12-21(27)13-11-20/h4-15,18H,3,16-17H2,1-2H3,(H,28,31) |
| InChIKey | DBKRJEQPJAMIDG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |