About 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene
6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene (PubChem CID 170094714) has the molecular formula C20H18F2
and a molecular weight of 296.36 g/mol. Its IUPAC name is 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene.
Molecular Properties
| Compound Name | 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene |
| PubChem CID | 170094714 |
| Molecular Formula | C20H18F2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene |
| SMILES | Cc1cc2ccc(Cc3ccc(F)c(F)c3C)cc2cc1C |
| InChI | InChI=1S/C20H18F2/c1-12-8-17-5-4-15(11-18(17)9-13(12)2)10-16-6-7-19(21)20(22)14(16)3/h4-9,11H,10H2,1-3H3 |
| InChIKey | RXYBHHBFMGAGIK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene?
The IUPAC name of 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene (CID 170094714) is 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene.
What is the SMILES notation for 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene?
The canonical SMILES for 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene is Cc1cc2ccc(Cc3ccc(F)c(F)c3C)cc2cc1C.
What is the InChIKey of 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene?
The InChIKey is RXYBHHBFMGAGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2/c1-12-8-17-5-4-15(11-18(17)9-13(12)2)10-16-6-7-19(21)20(22)14(16)3/h4-9,11H,10H2,1-3H3.
What are the key properties of 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene?
6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene has a molecular weight of 296.36 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-difluoro-2-methylphenyl)methyl]-2,3-dimethylnaphthalene is sourced from PubChem (CID 170094714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).