C18H25F2NO — CID 170094998
(5Z)-10-(1,1-difluoroethyl)-5-ethylidene-6,10-dimethyl-1,2,3,6,7,9-hexahydro-3-benzazonin-4-one (PubChem CID 170094998) has the molecular formula C18H25F2NO and a molecular weight of 309.40 g/mol. Its IUPAC name is (5Z)-10-(1,1-difluoroethyl)-5-ethylidene-6,10-dimethyl-1,2,3,6,7,9-hexahydro-3-benzazonin-4-one.
| Compound Name | (5Z)-10-(1,1-difluoroethyl)-5-ethylidene-6,10-dimethyl-1,2,3,6,7,9-hexahydro-3-benzazonin-4-one |
|---|---|
| PubChem CID | 170094998 |
| Molecular Formula | C18H25F2NO |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (5Z)-10-(1,1-difluoroethyl)-5-ethylidene-6,10-dimethyl-1,2,3,6,7,9-hexahydro-3-benzazonin-4-one |
| SMILES | C/C=C1\C(=O)NCCC2=CC(C)(C(C)(F)F)CC=C2CC1C |
| InChI | InChI=1S/C18H25F2NO/c1-5-15-12(2)10-13-6-8-17(3,18(4,19)20)11-14(13)7-9-21-16(15)22/h5-6,11-12H,7-10H2,1-4H3,(H,21,22)/b15-5- |
| InChIKey | LMLMUIWOHMUKQO-WCSRMQSCSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|