C45H30N4O — CID 170095080
7-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(3-phenylphenyl)dibenzofuran-2-amine (PubChem CID 170095080) has the molecular formula C45H30N4O and a molecular weight of 642.76 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(3-phenylphenyl)dibenzofuran-2-amine.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(3-phenylphenyl)dibenzofuran-2-amine |
|---|---|
| PubChem CID | 170095080 |
| Molecular Formula | C45H30N4O |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(3-phenylphenyl)dibenzofuran-2-amine |
| SMILES | c1ccc(-c2cccc(N(c3ccccc3)c3ccc4oc5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc5c4c3)c2)cc1 |
| InChI | InChI=1S/C45H30N4O/c1-5-14-31(15-6-1)34-20-13-23-37(28-34)49(36-21-11-4-12-22-36)38-25-27-41-40(30-38)39-26-24-35(29-42(39)50-41)45-47-43(32-16-7-2-8-17-32)46-44(48-45)33-18-9-3-10-19-33/h1-30H |
| InChIKey | ZHBSCTJHIYOPGZ-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |