C33H39N3O2 — CID 170095544
N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-N-[3-[2-(1H-pyrazol-4-yl)ethynyl]phenyl]cyclohexanecarboxamide (PubChem CID 170095544) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-N-[3-[2-(1H-pyrazol-4-yl)ethynyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-N-[3-[2-(1H-pyrazol-4-yl)ethynyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 170095544 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | N-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]-N-[3-[2-(1H-pyrazol-4-yl)ethynyl]phenyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(C2CCC(CN(C(=O)C3CCCCC3)c3cccc(C#Cc4cn[nH]c4)c3)CC2)cc1C |
| InChI | InChI=1S/C33H39N3O2/c1-24-19-30(17-18-32(24)38-2)28-15-13-26(14-16-28)23-36(33(37)29-8-4-3-5-9-29)31-10-6-7-25(20-31)11-12-27-21-34-35-22-27/h6-7,10,17-22,26,28-29H,3-5,8-9,13-16,23H2,1-2H3,(H,34,35) |
| InChIKey | LMEKQQVCRJBAHM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|