C28H30ClN3O2 — CID 17009562
4-chloro-N-[1-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17009562) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 4-chloro-N-[1-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[1-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17009562 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-chloro-N-[1-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1cccc(C)c1OCCCCn1c(C(C)NC(=O)c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C28H30ClN3O2/c1-19-9-8-10-20(2)26(19)34-18-7-6-17-32-25-12-5-4-11-24(25)31-27(32)21(3)30-28(33)22-13-15-23(29)16-14-22/h4-5,8-16,21H,6-7,17-18H2,1-3H3,(H,30,33) |
| InChIKey | LXOVEUZJUNQTNZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|