C57H42N4O — CID 170096041
N,N-bis(9,9-dimethylfluoren-2-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-amine (PubChem CID 170096041) has the molecular formula C57H42N4O and a molecular weight of 798.99 g/mol. Its IUPAC name is N,N-bis(9,9-dimethylfluoren-2-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-amine.
| Compound Name | N,N-bis(9,9-dimethylfluoren-2-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 170096041 |
| Molecular Formula | C57H42N4O |
| Molecular Weight | 798.99 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | N,N-bis(9,9-dimethylfluoren-2-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3cccc4c3oc3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc34)cc21 |
| InChI | InChI=1S/C57H42N4O/c1-56(2)46-23-13-11-20-40(46)42-30-27-38(33-48(42)56)61(39-28-31-43-41-21-12-14-24-47(41)57(3,4)49(43)34-39)50-25-15-22-45-44-29-26-37(32-51(44)62-52(45)50)55-59-53(35-16-7-5-8-17-35)58-54(60-55)36-18-9-6-10-19-36/h5-34H,1-4H3 |
| InChIKey | KUKNUKZGXUESKV-UHFFFAOYSA-N |
| XLogP | 14.85 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.99 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |