C19H17F24N — CID 170096057
N-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononyl)-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-N-methylnonan-1-amine (PubChem CID 170096057) has the molecular formula C19H17F24N and a molecular weight of 715.30 g/mol. Its IUPAC name is N-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononyl)-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-N-methylnonan-1-amine.
| Compound Name | N-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononyl)-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-N-methylnonan-1-amine |
|---|---|
| PubChem CID | 170096057 |
| Molecular Formula | C19H17F24N |
| Molecular Weight | 715.30 g/mol |
| Exact Mass | 715.10 |
| IUPAC Name | N-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononyl)-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-N-methylnonan-1-amine |
| SMILES | CN(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H17F24N/c1-44(6-2-4-10(24,25)14(32,33)18(40,41)16(36,37)12(28,29)8(20)21)7-3-5-11(26,27)15(34,35)19(42,43)17(38,39)13(30,31)9(22)23/h8-9H,2-7H2,1H3 |
| InChIKey | WISVXWGBDHCLGG-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.30 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|