C51H34N4S — CID 170096283
N-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-N,4-diphenylaniline (PubChem CID 170096283) has the molecular formula C51H34N4S and a molecular weight of 734.93 g/mol. Its IUPAC name is N-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 170096283 |
| Molecular Formula | C51H34N4S |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | N-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-N,4-diphenylaniline |
| SMILES | c1ccc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc5sc6cc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)ccc6c5c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C51H34N4S/c1-5-13-35(14-6-1)36-21-27-43(28-22-36)55(42-19-11-4-12-20-42)44-29-23-37(24-30-44)40-26-32-47-46(33-40)45-31-25-41(34-48(45)56-47)51-53-49(38-15-7-2-8-16-38)52-50(54-51)39-17-9-3-10-18-39/h1-34H |
| InChIKey | LPVFGAWBHKAHGC-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |