About (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane
(1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane (PubChem CID 170097259) has the molecular formula C20H37NO
and a molecular weight of 307.52 g/mol. Its IUPAC name is (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane.
Molecular Properties
| Compound Name | (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane |
| PubChem CID | 170097259 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane |
| SMILES | CN1C2CCCCCC(CC2)O[C@H]2CCCCCCC1CC2 |
| InChI | InChI=1S/C20H37NO/c1-21-17-9-5-2-3-7-11-19(15-13-17)22-20-12-8-4-6-10-18(21)14-16-20/h17-20H,2-16H2,1H3/t17?,18?,19-,20?/m0/s1 |
| InChIKey | FMHXIPIICDYHMP-LWCMGDNJSA-N |
| XLogP | 5.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane?
The IUPAC name of (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane (CID 170097259) is (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane.
What is the SMILES notation for (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane?
The canonical SMILES for (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane is CN1C2CCCCCC(CC2)O[C@H]2CCCCCCC1CC2.
What is the InChIKey of (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane?
The InChIKey is FMHXIPIICDYHMP-LWCMGDNJSA-N. The full InChI is InChI=1S/C20H37NO/c1-21-17-9-5-2-3-7-11-19(15-13-17)22-20-12-8-4-6-10-18(21)14-16-20/h17-20H,2-16H2,1H3/t17?,18?,19-,20?/m0/s1.
What are the key properties of (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane?
(1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane has a molecular weight of 307.52 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-10-methyl-2-oxa-10-azatricyclo[9.6.2.23,9]henicosane is sourced from PubChem (CID 170097259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).