C25H37N3O — CID 170097440
N-cyclohexyl-3-(2-cyclohexyl-6-methylbenzimidazol-1-yl)-N-ethylpropanamide (PubChem CID 170097440) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is N-cyclohexyl-3-(2-cyclohexyl-6-methylbenzimidazol-1-yl)-N-ethylpropanamide.
| Compound Name | N-cyclohexyl-3-(2-cyclohexyl-6-methylbenzimidazol-1-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 170097440 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | N-cyclohexyl-3-(2-cyclohexyl-6-methylbenzimidazol-1-yl)-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCn1c(C2CCCCC2)nc2ccc(C)cc21)C1CCCCC1 |
| InChI | InChI=1S/C25H37N3O/c1-3-27(21-12-8-5-9-13-21)24(29)16-17-28-23-18-19(2)14-15-22(23)26-25(28)20-10-6-4-7-11-20/h14-15,18,20-21H,3-13,16-17H2,1-2H3 |
| InChIKey | IZCJDVWWHNJBGY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |