About (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine
(1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine (PubChem CID 170098085) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
| PubChem CID | 170098085 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
| SMILES | CC1=CC2C[C@H]2C(C)=C1N |
| InChI | InChI=1S/C9H13N/c1-5-3-7-4-8(7)6(2)9(5)10/h3,7-8H,4,10H2,1-2H3/t7?,8-/m0/s1 |
| InChIKey | OBXLJUFVONXFST-MQWKRIRWSA-N |
| XLogP | 1.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
The IUPAC name of (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine (CID 170098085) is (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine.
What is the SMILES notation for (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
The canonical SMILES for (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine is CC1=CC2C[C@H]2C(C)=C1N.
What is the InChIKey of (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
The InChIKey is OBXLJUFVONXFST-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H13N/c1-5-3-7-4-8(7)6(2)9(5)10/h3,7-8H,4,10H2,1-2H3/t7?,8-/m0/s1.
What are the key properties of (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine?
(1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine has a molecular weight of 135.21 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,4-dimethylbicyclo[4.1.0]hepta-2,4-dien-3-amine is sourced from PubChem (CID 170098085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).