C10H11F6N — CID 170098100
(E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-en-1-imine (PubChem CID 170098100) has the molecular formula C10H11F6N and a molecular weight of 259.19 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-en-1-imine.
| Compound Name | (E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 170098100 |
| Molecular Formula | C10H11F6N |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-en-1-imine |
| SMILES | CC/C=C(/N=C/C=C(\C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F6N/c1-3-4-8(10(14,15)16)17-6-5-7(2)9(11,12)13/h4-6H,3H2,1-2H3/b7-5+,8-4+,17-6+ |
| InChIKey | RYFVHZMUILUZJU-NGKGEDMOSA-N |
| XLogP | 4.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|