C8H15NO — CID 170098111
(3aS,6S,6aR)-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[b]pyrrol-6-ol (PubChem CID 170098111) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3aS,6S,6aR)-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[b]pyrrol-6-ol.
| Compound Name | (3aS,6S,6aR)-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[b]pyrrol-6-ol |
|---|---|
| PubChem CID | 170098111 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3aS,6S,6aR)-6-methyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[b]pyrrol-6-ol |
| SMILES | C[C@]1(O)CC[C@H]2CCN[C@H]21 |
| InChI | InChI=1S/C8H15NO/c1-8(10)4-2-6-3-5-9-7(6)8/h6-7,9-10H,2-5H2,1H3/t6-,7+,8-/m0/s1 |
| InChIKey | LRQVGNNZPKMAPM-RNJXMRFFSA-N |
| XLogP | 0.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |