C11H10F6N2 — CID 170098114
(E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-enimidoyl cyanide (PubChem CID 170098114) has the molecular formula C11H10F6N2 and a molecular weight of 284.20 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-enimidoyl cyanide.
| Compound Name | (E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-enimidoyl cyanide |
|---|---|
| PubChem CID | 170098114 |
| Molecular Formula | C11H10F6N2 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-methyl-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]but-2-enimidoyl cyanide |
| SMILES | CC/C=C(/N=C(C#N)/C=C(\C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F6N2/c1-3-4-9(11(15,16)17)19-8(6-18)5-7(2)10(12,13)14/h4-5H,3H2,1-2H3/b7-5+,9-4+,19-8- |
| InChIKey | YUBHQXVUKFQNTB-GQMDDOFXSA-N |
| XLogP | 4.32 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|