C42H81N3O2 — CID 170098660
(9Z,12Z)-N-[1-(decylamino)-3-ethyl-1-oxoheptan-2-yl]-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide (PubChem CID 170098660) has the molecular formula C42H81N3O2 and a molecular weight of 660.13 g/mol. Its IUPAC name is (9Z,12Z)-N-[1-(decylamino)-3-ethyl-1-oxoheptan-2-yl]-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[1-(decylamino)-3-ethyl-1-oxoheptan-2-yl]-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 170098660 |
| Molecular Formula | C42H81N3O2 |
| Molecular Weight | 660.13 g/mol |
| Exact Mass | 659.63 |
| IUPAC Name | (9Z,12Z)-N-[1-(decylamino)-3-ethyl-1-oxoheptan-2-yl]-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N(CCCN(C)C)C(C(=O)NCCCCCCCCCC)C(CC)CCCC |
| InChI | InChI=1S/C42H81N3O2/c1-7-11-14-16-18-20-21-22-23-24-25-26-27-29-31-35-40(46)45(38-33-37-44(5)6)41(39(10-4)34-13-9-3)42(47)43-36-32-30-28-19-17-15-12-8-2/h18,20,22-23,39,41H,7-17,19,21,24-38H2,1-6H3,(H,43,47)/b20-18-,23-22- |
| InChIKey | MSZYFKRRZYKPRB-AKXWPXBYSA-N |
| XLogP | 11.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.13 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|