C11H10F9N — CID 170099012
N-[(2Z)-3-ethyl-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]-1,1,1-trifluoropropan-2-imine (PubChem CID 170099012) has the molecular formula C11H10F9N and a molecular weight of 327.19 g/mol. Its IUPAC name is N-[(2Z)-3-ethyl-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]-1,1,1-trifluoropropan-2-imine.
| Compound Name | N-[(2Z)-3-ethyl-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]-1,1,1-trifluoropropan-2-imine |
|---|---|
| PubChem CID | 170099012 |
| Molecular Formula | C11H10F9N |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[(2Z)-3-ethyl-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]-1,1,1-trifluoropropan-2-imine |
| SMILES | C=C(/C(CC)=C(\N=C(/C)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F9N/c1-4-7(5(2)9(12,13)14)8(11(18,19)20)21-6(3)10(15,16)17/h2,4H2,1,3H3/b8-7-,21-6+ |
| InChIKey | SQMVRIRUYVHRRQ-GXVDQVABSA-N |
| XLogP | 5.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|