C33H32F2N4O4S2 — CID 170099511
2-[5-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-(1-hydroxyprop-2-enyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thieno[3,2-c]pyridin-4-yl]-2-pyridinyl]propan-2-ol (PubChem CID 170099511) has the molecular formula C33H32F2N4O4S2 and a molecular weight of 650.77 g/mol. Its IUPAC name is 2-[5-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-(1-hydroxyprop-2-enyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thieno[3,2-c]pyridin-4-yl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-(1-hydroxyprop-2-enyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thieno[3,2-c]pyridin-4-yl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 170099511 |
| Molecular Formula | C33H32F2N4O4S2 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 2-[5-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-[5-(1-hydroxyprop-2-enyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thieno[3,2-c]pyridin-4-yl]-2-pyridinyl]propan-2-ol |
| SMILES | C=CC(O)N1CCc2nc(-c3nc(-c4ccc(C(C)(C)O)nc4)c4ccsc4c3-c3c(F)cc(F)cc3OCCOC)sc2C1 |
| InChI | InChI=1S/C33H32F2N4O4S2/c1-5-26(40)39-10-8-22-24(17-39)45-32(37-22)30-28(27-21(35)14-19(34)15-23(27)43-12-11-42-4)31-20(9-13-44-31)29(38-30)18-6-7-25(36-16-18)33(2,3)41/h5-7,9,13-16,26,40-41H,1,8,10-12,17H2,2-4H3 |
| InChIKey | JJWLWGOGEHNPDD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|