C27H47N — CID 170099835
5-ethyl-N-hexan-2-yl-3,4-dimethyl-6-(5-methylcycloocta-2,3,6-trien-1-yl)octan-1-imine (PubChem CID 170099835) has the molecular formula C27H47N and a molecular weight of 385.68 g/mol. Its IUPAC name is 5-ethyl-N-hexan-2-yl-3,4-dimethyl-6-(5-methylcycloocta-2,3,6-trien-1-yl)octan-1-imine.
| Compound Name | 5-ethyl-N-hexan-2-yl-3,4-dimethyl-6-(5-methylcycloocta-2,3,6-trien-1-yl)octan-1-imine |
|---|---|
| PubChem CID | 170099835 |
| Molecular Formula | C27H47N |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | 5-ethyl-N-hexan-2-yl-3,4-dimethyl-6-(5-methylcycloocta-2,3,6-trien-1-yl)octan-1-imine |
| SMILES | CCCCC(C)/N=C/CC(C)C(C)C(CC)C(CC)C1C=C=CC(C)C=CC1 |
| InChI | InChI=1S/C27H47N/c1-8-11-16-23(6)28-20-19-22(5)24(7)26(9-2)27(10-3)25-17-12-14-21(4)15-13-18-25/h12,14-15,18,20-27H,8-11,16-17,19H2,1-7H3/b14-12?,28-20+ |
| InChIKey | FZJHGCGIPQRRBC-JIRJZGAPSA-N |
| XLogP | 8.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|