About 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline
6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline (PubChem CID 170099991) has the molecular formula C16H19N
and a molecular weight of 225.34 g/mol. Its IUPAC name is 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline |
| PubChem CID | 170099991 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline |
| SMILES | C=C(c1ccc2c(c1)C=CNC2)C1CCCC1 |
| InChI | InChI=1S/C16H19N/c1-12(13-4-2-3-5-13)14-6-7-16-11-17-9-8-15(16)10-14/h6-10,13,17H,1-5,11H2 |
| InChIKey | WWQGQZZHTCPECI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline?
The IUPAC name of 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline (CID 170099991) is 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline.
What is the SMILES notation for 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline?
The canonical SMILES for 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline is C=C(c1ccc2c(c1)C=CNC2)C1CCCC1.
What is the InChIKey of 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline?
The InChIKey is WWQGQZZHTCPECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-12(13-4-2-3-5-13)14-6-7-16-11-17-9-8-15(16)10-14/h6-10,13,17H,1-5,11H2.
What are the key properties of 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline?
6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline has a molecular weight of 225.34 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-cyclopentylethenyl)-1,2-dihydroisoquinoline is sourced from PubChem (CID 170099991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).