C18H26F3N3O2S — CID 170099996
N-[(3R)-1-[2-[N-methyl-4-(2,2,2-trifluoroethyl)anilino]ethyl]piperidin-3-yl]ethenesulfonamide (PubChem CID 170099996) has the molecular formula C18H26F3N3O2S and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[(3R)-1-[2-[N-methyl-4-(2,2,2-trifluoroethyl)anilino]ethyl]piperidin-3-yl]ethenesulfonamide.
| Compound Name | N-[(3R)-1-[2-[N-methyl-4-(2,2,2-trifluoroethyl)anilino]ethyl]piperidin-3-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 170099996 |
| Molecular Formula | C18H26F3N3O2S |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[(3R)-1-[2-[N-methyl-4-(2,2,2-trifluoroethyl)anilino]ethyl]piperidin-3-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)N[C@@H]1CCCN(CCN(C)c2ccc(CC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H26F3N3O2S/c1-3-27(25,26)22-16-5-4-10-24(14-16)12-11-23(2)17-8-6-15(7-9-17)13-18(19,20)21/h3,6-9,16,22H,1,4-5,10-14H2,2H3/t16-/m1/s1 |
| InChIKey | WARWBLLRVUPBAJ-MRXNPFEDSA-N |
| XLogP | 2.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|