C28H52N2 — CID 170100696
17-(2,5-dimethylhexyl)-8,10,13-trimethyl-2,3,4,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diamine (PubChem CID 170100696) has the molecular formula C28H52N2 and a molecular weight of 416.74 g/mol. Its IUPAC name is 17-(2,5-dimethylhexyl)-8,10,13-trimethyl-2,3,4,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diamine.
| Compound Name | 17-(2,5-dimethylhexyl)-8,10,13-trimethyl-2,3,4,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diamine |
|---|---|
| PubChem CID | 170100696 |
| Molecular Formula | C28H52N2 |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 416.41 |
| IUPAC Name | 17-(2,5-dimethylhexyl)-8,10,13-trimethyl-2,3,4,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diamine |
| SMILES | CC(C)CCC(C)CC1CCC2C1(C)CCC1C2(C)CCC2(N)CC(N)CCC12C |
| InChI | InChI=1S/C28H52N2/c1-19(2)7-8-20(3)17-21-9-10-23-25(21,4)13-12-24-26(23,5)15-16-28(30)18-22(29)11-14-27(24,28)6/h19-24H,7-18,29-30H2,1-6H3 |
| InChIKey | LRAKJFOPBPOCHC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |