C15H31N3O3 — CID 170100793
2-[4-(3-amino-3-methylbutoxy)pentanoylamino]-3-methylbutanamide (PubChem CID 170100793) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[4-(3-amino-3-methylbutoxy)pentanoylamino]-3-methylbutanamide.
| Compound Name | 2-[4-(3-amino-3-methylbutoxy)pentanoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 170100793 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 2-[4-(3-amino-3-methylbutoxy)pentanoylamino]-3-methylbutanamide |
| SMILES | CC(CCC(=O)NC(C(N)=O)C(C)C)OCCC(C)(C)N |
| InChI | InChI=1S/C15H31N3O3/c1-10(2)13(14(16)20)18-12(19)7-6-11(3)21-9-8-15(4,5)17/h10-11,13H,6-9,17H2,1-5H3,(H2,16,20)(H,18,19) |
| InChIKey | HMQVCULYCLGUNC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |