C30H34FN5 — CID 170101003
4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylbutan-1-amine (PubChem CID 170101003) has the molecular formula C30H34FN5 and a molecular weight of 483.64 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 170101003 |
| Molecular Formula | C30H34FN5 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1nc(N2CC3CCC(C2)N3)c2ccc(-c3cccc4ccccc34)c(F)c2n1 |
| InChI | InChI=1S/C30H34FN5/c1-35(2)17-6-5-12-27-33-29-26(30(34-27)36-18-21-13-14-22(19-36)32-21)16-15-25(28(29)31)24-11-7-9-20-8-3-4-10-23(20)24/h3-4,7-11,15-16,21-22,32H,5-6,12-14,17-19H2,1-2H3 |
| InChIKey | QCDVMRGJVXCPPG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|