About 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole
5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole (PubChem CID 170102175) has the molecular formula C15H8F3N5O2
and a molecular weight of 347.26 g/mol. Its IUPAC name is 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole.
Molecular Properties
| Compound Name | 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole |
| PubChem CID | 170102175 |
| Molecular Formula | C15H8F3N5O2 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole |
| SMILES | FC(F)(F)Oc1ccc(-c2onc3ccc(-c4nn[nH]n4)cc23)cc1 |
| InChI | InChI=1S/C15H8F3N5O2/c16-15(17,18)24-10-4-1-8(2-5-10)13-11-7-9(14-19-22-23-20-14)3-6-12(11)21-25-13/h1-7H,(H,19,20,22,23) |
| InChIKey | OPRMMWAPDMWRES-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole?
The IUPAC name of 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole (CID 170102175) is 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole.
What is the SMILES notation for 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole?
The canonical SMILES for 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole is FC(F)(F)Oc1ccc(-c2onc3ccc(-c4nn[nH]n4)cc23)cc1.
What is the InChIKey of 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole?
The InChIKey is OPRMMWAPDMWRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3N5O2/c16-15(17,18)24-10-4-1-8(2-5-10)13-11-7-9(14-19-22-23-20-14)3-6-12(11)21-25-13/h1-7H,(H,19,20,22,23).
What are the key properties of 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole?
5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole has a molecular weight of 347.26 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2H-tetrazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]-2,1-benzoxazole is sourced from PubChem (CID 170102175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).