C21H24Cl2N4O — CID 170103203
2-cyclopropyl-1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethanone (PubChem CID 170103203) has the molecular formula C21H24Cl2N4O and a molecular weight of 419.36 g/mol. Its IUPAC name is 2-cyclopropyl-1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethanone.
| Compound Name | 2-cyclopropyl-1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 170103203 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-cyclopropyl-1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethanone |
| SMILES | CN1c2c(Cl)c(Cl)cc(-c3ccn(C)n3)c2C2CN(C(=O)CC3CC3)CCC21 |
| InChI | InChI=1S/C21H24Cl2N4O/c1-25-7-5-16(24-25)13-10-15(22)20(23)21-19(13)14-11-27(8-6-17(14)26(21)2)18(28)9-12-3-4-12/h5,7,10,12,14,17H,3-4,6,8-9,11H2,1-2H3 |
| InChIKey | IUVOCNHRIVZXJF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |