C36H35N2+ — CID 170103530
25-ethenyl-3-methylidene-7-phenyl-6-propan-2-yl-26-aza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10,12,14,19,21,23,25-decaene (PubChem CID 170103530) has the molecular formula C36H35N2+ and a molecular weight of 495.69 g/mol. Its IUPAC name is 25-ethenyl-3-methylidene-7-phenyl-6-propan-2-yl-26-aza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10,12,14,19,21,23,25-decaene.
| Compound Name | 25-ethenyl-3-methylidene-7-phenyl-6-propan-2-yl-26-aza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10,12,14,19,21,23,25-decaene |
|---|---|
| PubChem CID | 170103530 |
| Molecular Formula | C36H35N2+ |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 25-ethenyl-3-methylidene-7-phenyl-6-propan-2-yl-26-aza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10,12,14,19,21,23,25-decaene |
| SMILES | C=CC1=NC2CC(=C)[n+]3cc(C(C)C)c(-c4ccccc4)cc3-c3ccccc3CCC2c2ccccc21 |
| InChI | InChI=1S/C36H35N2/c1-5-34-30-18-12-11-17-29(30)31-20-19-27-15-9-10-16-28(27)36-22-32(26-13-7-6-8-14-26)33(24(2)3)23-38(36)25(4)21-35(31)37-34/h5-18,22-24,31,35H,1,4,19-21H2,2-3H3/q+1 |
| InChIKey | SVSIOPPFJUHBJD-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 16.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|