About 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol
4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol (PubChem CID 170103963) has the molecular formula C26H44O
and a molecular weight of 372.64 g/mol. Its IUPAC name is 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol.
Molecular Properties
| Compound Name | 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol |
| PubChem CID | 170103963 |
| Molecular Formula | C26H44O |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol |
| SMILES | CC(C)(C)CCCCCCc1ccc(O)cc1CCCCCCC1(C)CC1 |
| InChI | InChI=1S/C26H44O/c1-25(2,3)17-11-7-5-9-13-22-15-16-24(27)21-23(22)14-10-6-8-12-18-26(4)19-20-26/h15-16,21,27H,5-14,17-20H2,1-4H3 |
| InChIKey | SGNIUOCACAZBHL-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol?
The IUPAC name of 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol (CID 170103963) is 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol.
What is the SMILES notation for 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol?
The canonical SMILES for 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol is CC(C)(C)CCCCCCc1ccc(O)cc1CCCCCCC1(C)CC1.
What is the InChIKey of 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol?
The InChIKey is SGNIUOCACAZBHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H44O/c1-25(2,3)17-11-7-5-9-13-22-15-16-24(27)21-23(22)14-10-6-8-12-18-26(4)19-20-26/h15-16,21,27H,5-14,17-20H2,1-4H3.
What are the key properties of 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol?
4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol has a molecular weight of 372.64 g/mol, XLogP of 8.22, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7,7-dimethyloctyl)-3-[6-(1-methylcyclopropyl)hexyl]phenol is sourced from PubChem (CID 170103963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).