About 4-methyldibenzothiophene-3,7-diol
4-methyldibenzothiophene-3,7-diol (PubChem CID 170104064) has the molecular formula C13H10O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-methyldibenzothiophene-3,7-diol.
Molecular Properties
| Compound Name | 4-methyldibenzothiophene-3,7-diol |
| PubChem CID | 170104064 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-methyldibenzothiophene-3,7-diol |
| SMILES | Cc1c(O)ccc2c1sc1cc(O)ccc12 |
| InChI | InChI=1S/C13H10O2S/c1-7-11(15)5-4-10-9-3-2-8(14)6-12(9)16-13(7)10/h2-6,14-15H,1H3 |
| InChIKey | ODGKMNAIACIOGN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyldibenzothiophene-3,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyldibenzothiophene-3,7-diol?
The IUPAC name of 4-methyldibenzothiophene-3,7-diol (CID 170104064) is 4-methyldibenzothiophene-3,7-diol.
What is the SMILES notation for 4-methyldibenzothiophene-3,7-diol?
The canonical SMILES for 4-methyldibenzothiophene-3,7-diol is Cc1c(O)ccc2c1sc1cc(O)ccc12.
What is the InChIKey of 4-methyldibenzothiophene-3,7-diol?
The InChIKey is ODGKMNAIACIOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S/c1-7-11(15)5-4-10-9-3-2-8(14)6-12(9)16-13(7)10/h2-6,14-15H,1H3.
What are the key properties of 4-methyldibenzothiophene-3,7-diol?
4-methyldibenzothiophene-3,7-diol has a molecular weight of 230.29 g/mol, XLogP of 3.77, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyldibenzothiophene-3,7-diol is sourced from PubChem (CID 170104064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).