About N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine (PubChem CID 170104283) has the molecular formula C14H23N
and a molecular weight of 205.35 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine |
| PubChem CID | 170104283 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine |
| SMILES | C=C/C=C\C(=C/C)CNC1CCCCC1 |
| InChI | InChI=1S/C14H23N/c1-3-5-9-13(4-2)12-15-14-10-7-6-8-11-14/h3-5,9,14-15H,1,6-8,10-12H2,2H3/b9-5-,13-4+ |
| InChIKey | NHVFKJTUXJXZNW-LUZXEPFRSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine?
The IUPAC name of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine (CID 170104283) is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine.
What is the SMILES notation for N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine?
The canonical SMILES for N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine is C=C/C=C\C(=C/C)CNC1CCCCC1.
What is the InChIKey of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine?
The InChIKey is NHVFKJTUXJXZNW-LUZXEPFRSA-N. The full InChI is InChI=1S/C14H23N/c1-3-5-9-13(4-2)12-15-14-10-7-6-8-11-14/h3-5,9,14-15H,1,6-8,10-12H2,2H3/b9-5-,13-4+.
What are the key properties of N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine?
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine has a molecular weight of 205.35 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]cyclohexanamine is sourced from PubChem (CID 170104283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).