About 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine
1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine (PubChem CID 170104318) has the molecular formula C8H16F2N2O
and a molecular weight of 194.22 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine.
Molecular Properties
| Compound Name | 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine |
| PubChem CID | 170104318 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine |
| SMILES | CNC(C)OC1CN(CC(F)F)C1 |
| InChI | InChI=1S/C8H16F2N2O/c1-6(11-2)13-7-3-12(4-7)5-8(9)10/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | YSYNJDNJFDVBJJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine?
The IUPAC name of 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine (CID 170104318) is 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine.
What is the SMILES notation for 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine?
The canonical SMILES for 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine is CNC(C)OC1CN(CC(F)F)C1.
What is the InChIKey of 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine?
The InChIKey is YSYNJDNJFDVBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O/c1-6(11-2)13-7-3-12(4-7)5-8(9)10/h6-8,11H,3-5H2,1-2H3.
What are the key properties of 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine?
1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine has a molecular weight of 194.22 g/mol, XLogP of 0.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,2-difluoroethyl)azetidin-3-yl]oxy-N-methylethanamine is sourced from PubChem (CID 170104318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).