C15H27N2+ — CID 170104841
(1E,4E)-N,N-dimethyl-5-(1-methyl-2,3,4,5,6,7-hexahydroazocin-1-ium-8-yl)penta-1,4-dien-1-amine (PubChem CID 170104841) has the molecular formula C15H27N2+ and a molecular weight of 235.40 g/mol. Its IUPAC name is (1E,4E)-N,N-dimethyl-5-(1-methyl-2,3,4,5,6,7-hexahydroazocin-1-ium-8-yl)penta-1,4-dien-1-amine.
| Compound Name | (1E,4E)-N,N-dimethyl-5-(1-methyl-2,3,4,5,6,7-hexahydroazocin-1-ium-8-yl)penta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 170104841 |
| Molecular Formula | C15H27N2+ |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.22 |
| IUPAC Name | (1E,4E)-N,N-dimethyl-5-(1-methyl-2,3,4,5,6,7-hexahydroazocin-1-ium-8-yl)penta-1,4-dien-1-amine |
| SMILES | CN(C)/C=C/C/C=C/C1=[N+](\C)CCCCCC1 |
| InChI | InChI=1S/C15H27N2/c1-16(2)13-9-6-8-12-15-11-7-4-5-10-14-17(15)3/h8-9,12-13H,4-7,10-11,14H2,1-3H3/q+1/b12-8+,13-9+,17-15+ |
| InChIKey | SNNSVJXVFZUNJJ-RRJOVMFDSA-N |
| XLogP | 3.06 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|