C44H40F3N7O2 — CID 170104979
tert-butyl (4S)-3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]-4-fluoropiperidine-1-carboxylate (PubChem CID 170104979) has the molecular formula C44H40F3N7O2 and a molecular weight of 755.85 g/mol. Its IUPAC name is tert-butyl (4S)-3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170104979 |
| Molecular Formula | C44H40F3N7O2 |
| Molecular Weight | 755.85 g/mol |
| Exact Mass | 755.32 |
| IUPAC Name | tert-butyl (4S)-3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](F)C(Nc2nc(-c3cnc4cc(-c5cncn5C(c5ccccc5)(c5ccccc5)c5ccccc5)ccn34)c(F)cc2F)C1 |
| InChI | InChI=1S/C44H40F3N7O2/c1-43(2,3)56-42(55)52-21-20-33(45)36(27-52)50-41-35(47)24-34(46)40(51-41)38-26-49-39-23-29(19-22-53(38)39)37-25-48-28-54(37)44(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-19,22-26,28,33,36H,20-21,27H2,1-3H3,(H,50,51)/t33-,36?/m0/s1 |
| InChIKey | UELBNJOBGFWTAL-LUEXLKCISA-N |
| XLogP | 9.14 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.85 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|