C23H39I — CID 170105041
1-(4,4-dimethylhexyl)-3-(4-iodo-4-methylpentyl)-2,4,5-trimethylbenzene (PubChem CID 170105041) has the molecular formula C23H39I and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-(4,4-dimethylhexyl)-3-(4-iodo-4-methylpentyl)-2,4,5-trimethylbenzene.
| Compound Name | 1-(4,4-dimethylhexyl)-3-(4-iodo-4-methylpentyl)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 170105041 |
| Molecular Formula | C23H39I |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1-(4,4-dimethylhexyl)-3-(4-iodo-4-methylpentyl)-2,4,5-trimethylbenzene |
| SMILES | CCC(C)(C)CCCc1cc(C)c(C)c(CCCC(C)(C)I)c1C |
| InChI | InChI=1S/C23H39I/c1-9-22(5,6)14-10-12-20-16-17(2)18(3)21(19(20)4)13-11-15-23(7,8)24/h16H,9-15H2,1-8H3 |
| InChIKey | LBTCJCBBWKBVGJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|