About 4-methylthiane-4-thiol
4-methylthiane-4-thiol (PubChem CID 170105339) has the molecular formula C6H12S2
and a molecular weight of 148.30 g/mol. Its IUPAC name is 4-methylthiane-4-thiol.
Molecular Properties
| Compound Name | 4-methylthiane-4-thiol |
| PubChem CID | 170105339 |
| Molecular Formula | C6H12S2 |
| Molecular Weight | 148.30 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 4-methylthiane-4-thiol |
| SMILES | CC1(S)CCSCC1 |
| InChI | InChI=1S/C6H12S2/c1-6(7)2-4-8-5-3-6/h7H,2-5H2,1H3 |
| InChIKey | FJXAJVNZZPBPKV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylthiane-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylthiane-4-thiol?
The IUPAC name of 4-methylthiane-4-thiol (CID 170105339) is 4-methylthiane-4-thiol.
What is the SMILES notation for 4-methylthiane-4-thiol?
The canonical SMILES for 4-methylthiane-4-thiol is CC1(S)CCSCC1.
What is the InChIKey of 4-methylthiane-4-thiol?
The InChIKey is FJXAJVNZZPBPKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S2/c1-6(7)2-4-8-5-3-6/h7H,2-5H2,1H3.
What are the key properties of 4-methylthiane-4-thiol?
4-methylthiane-4-thiol has a molecular weight of 148.30 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylthiane-4-thiol is sourced from PubChem (CID 170105339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).