C24H37IO2 — CID 170105889
2-[5-(1-ethylcyclopropyl)pentyl]-6-[5-(1-iodocyclopropyl)pentyl]benzene-1,4-diol (PubChem CID 170105889) has the molecular formula C24H37IO2 and a molecular weight of 484.46 g/mol. Its IUPAC name is 2-[5-(1-ethylcyclopropyl)pentyl]-6-[5-(1-iodocyclopropyl)pentyl]benzene-1,4-diol.
| Compound Name | 2-[5-(1-ethylcyclopropyl)pentyl]-6-[5-(1-iodocyclopropyl)pentyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 170105889 |
| Molecular Formula | C24H37IO2 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-[5-(1-ethylcyclopropyl)pentyl]-6-[5-(1-iodocyclopropyl)pentyl]benzene-1,4-diol |
| SMILES | CCC1(CCCCCc2cc(O)cc(CCCCCC3(I)CC3)c2O)CC1 |
| InChI | InChI=1S/C24H37IO2/c1-2-23(13-14-23)11-7-3-5-9-19-17-21(26)18-20(22(19)27)10-6-4-8-12-24(25)15-16-24/h17-18,26-27H,2-16H2,1H3 |
| InChIKey | VVRUCJOOCZZGMO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|