About N-iodo-N,2-dimethyloctan-1-amine
N-iodo-N,2-dimethyloctan-1-amine (PubChem CID 170106040) has the molecular formula C10H22IN
and a molecular weight of 283.20 g/mol. Its IUPAC name is N-iodo-N,2-dimethyloctan-1-amine.
Molecular Properties
| Compound Name | N-iodo-N,2-dimethyloctan-1-amine |
| PubChem CID | 170106040 |
| Molecular Formula | C10H22IN |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-iodo-N,2-dimethyloctan-1-amine |
| SMILES | CCCCCCC(C)CN(C)I |
| InChI | InChI=1S/C10H22IN/c1-4-5-6-7-8-10(2)9-12(3)11/h10H,4-9H2,1-3H3 |
| InChIKey | FAVOGPWYMIFNCI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-N,2-dimethyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-N,2-dimethyloctan-1-amine?
The IUPAC name of N-iodo-N,2-dimethyloctan-1-amine (CID 170106040) is N-iodo-N,2-dimethyloctan-1-amine.
What is the SMILES notation for N-iodo-N,2-dimethyloctan-1-amine?
The canonical SMILES for N-iodo-N,2-dimethyloctan-1-amine is CCCCCCC(C)CN(C)I.
What is the InChIKey of N-iodo-N,2-dimethyloctan-1-amine?
The InChIKey is FAVOGPWYMIFNCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22IN/c1-4-5-6-7-8-10(2)9-12(3)11/h10H,4-9H2,1-3H3.
What are the key properties of N-iodo-N,2-dimethyloctan-1-amine?
N-iodo-N,2-dimethyloctan-1-amine has a molecular weight of 283.20 g/mol, XLogP of 3.87, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-N,2-dimethyloctan-1-amine is sourced from PubChem (CID 170106040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).