About 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol
2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol (PubChem CID 170106596) has the molecular formula C26H42O2
and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol |
| PubChem CID | 170106596 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol |
| SMILES | CCC1(CCCCCCc2c(O)ccc(O)c2CCCCCC2(C)CC2)CC1 |
| InChI | InChI=1S/C26H42O2/c1-3-26(19-20-26)16-10-5-4-7-11-21-22(24(28)14-13-23(21)27)12-8-6-9-15-25(2)17-18-25/h13-14,27-28H,3-12,15-20H2,1-2H3 |
| InChIKey | WEIPAYDSMTXKJM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol?
The IUPAC name of 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol (CID 170106596) is 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol.
What is the SMILES notation for 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol?
The canonical SMILES for 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol is CCC1(CCCCCCc2c(O)ccc(O)c2CCCCCC2(C)CC2)CC1.
What is the InChIKey of 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol?
The InChIKey is WEIPAYDSMTXKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O2/c1-3-26(19-20-26)16-10-5-4-7-11-21-22(24(28)14-13-23(21)27)12-8-6-9-15-25(2)17-18-25/h13-14,27-28H,3-12,15-20H2,1-2H3.
What are the key properties of 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol?
2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol has a molecular weight of 386.62 g/mol, XLogP of 7.68, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(1-ethylcyclopropyl)hexyl]-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol is sourced from PubChem (CID 170106596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).