C20H36FN3 — CID 170106627
(Z)-4-N-[(2E)-4-fluoropenta-2,4-dien-2-yl]-5-methyl-1-N-(3-piperidin-1-ylpropyl)hex-1-ene-1,4-diamine (PubChem CID 170106627) has the molecular formula C20H36FN3 and a molecular weight of 337.53 g/mol. Its IUPAC name is (Z)-4-N-[(2E)-4-fluoropenta-2,4-dien-2-yl]-5-methyl-1-N-(3-piperidin-1-ylpropyl)hex-1-ene-1,4-diamine.
| Compound Name | (Z)-4-N-[(2E)-4-fluoropenta-2,4-dien-2-yl]-5-methyl-1-N-(3-piperidin-1-ylpropyl)hex-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 170106627 |
| Molecular Formula | C20H36FN3 |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.29 |
| IUPAC Name | (Z)-4-N-[(2E)-4-fluoropenta-2,4-dien-2-yl]-5-methyl-1-N-(3-piperidin-1-ylpropyl)hex-1-ene-1,4-diamine |
| SMILES | C=C(F)/C=C(\C)NC(C/C=C\NCCCN1CCCCC1)C(C)C |
| InChI | InChI=1S/C20H36FN3/c1-17(2)20(23-19(4)16-18(3)21)10-8-11-22-12-9-15-24-13-6-5-7-14-24/h8,11,16-17,20,22-23H,3,5-7,9-10,12-15H2,1-2,4H3/b11-8-,19-16+ |
| InChIKey | OACZMSBOYYKGSG-SZXXTAFNSA-N |
| XLogP | 4.36 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|