C19H14F3INO2P — CID 170106937
(2R)-6-(2,3-difluoro-5-iodo-4-methyl-6-phosphanylphenyl)-7-fluoro-2-methyl-4-prop-2-ynyl-1,4-benzoxazin-3-one (PubChem CID 170106937) has the molecular formula C19H14F3INO2P and a molecular weight of 503.20 g/mol. Its IUPAC name is (2R)-6-(2,3-difluoro-5-iodo-4-methyl-6-phosphanylphenyl)-7-fluoro-2-methyl-4-prop-2-ynyl-1,4-benzoxazin-3-one.
| Compound Name | (2R)-6-(2,3-difluoro-5-iodo-4-methyl-6-phosphanylphenyl)-7-fluoro-2-methyl-4-prop-2-ynyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170106937 |
| Molecular Formula | C19H14F3INO2P |
| Molecular Weight | 503.20 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | (2R)-6-(2,3-difluoro-5-iodo-4-methyl-6-phosphanylphenyl)-7-fluoro-2-methyl-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)[C@@H](C)Oc2cc(F)c(-c3c(F)c(F)c(C)c(I)c3P)cc21 |
| InChI | InChI=1S/C19H14F3INO2P/c1-4-5-24-12-6-10(11(20)7-13(12)26-9(3)19(24)25)14-16(22)15(21)8(2)17(23)18(14)27/h1,6-7,9H,5,27H2,2-3H3/t9-/m1/s1 |
| InChIKey | TZBFAIQXWBRCDV-SECBINFHSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|