C15H14BrFN4O — CID 170106979
(5R)-9-bromo-5-ethyl-10-fluoro-2-methyl-2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one (PubChem CID 170106979) has the molecular formula C15H14BrFN4O and a molecular weight of 365.21 g/mol. Its IUPAC name is (5R)-9-bromo-5-ethyl-10-fluoro-2-methyl-2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one.
| Compound Name | (5R)-9-bromo-5-ethyl-10-fluoro-2-methyl-2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one |
|---|---|
| PubChem CID | 170106979 |
| Molecular Formula | C15H14BrFN4O |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (5R)-9-bromo-5-ethyl-10-fluoro-2-methyl-2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),8(16),9,11,13-pentaen-3-one |
| SMILES | CC[C@@H]1CNc2c(Br)c(F)cc3ncc4c(c23)n1c(=O)n4C |
| InChI | InChI=1S/C15H14BrFN4O/c1-3-7-5-19-13-11-9(4-8(17)12(13)16)18-6-10-14(11)21(7)15(22)20(10)2/h4,6-7,19H,3,5H2,1-2H3/t7-/m1/s1 |
| InChIKey | BHTPDUCDLICMCS-SSDOTTSWSA-N |
| XLogP | 3.17 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |