C21H16F5N2O3P — CID 170107053
N-[4-(2,2-difluoro-3-oxo-7-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-2,3,5-trifluoro-6-methylphenyl]-N-methylacetamide (PubChem CID 170107053) has the molecular formula C21H16F5N2O3P and a molecular weight of 470.33 g/mol. Its IUPAC name is N-[4-(2,2-difluoro-3-oxo-7-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-2,3,5-trifluoro-6-methylphenyl]-N-methylacetamide.
| Compound Name | N-[4-(2,2-difluoro-3-oxo-7-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-2,3,5-trifluoro-6-methylphenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 170107053 |
| Molecular Formula | C21H16F5N2O3P |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[4-(2,2-difluoro-3-oxo-7-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-2,3,5-trifluoro-6-methylphenyl]-N-methylacetamide |
| SMILES | C#CCN1C(=O)C(F)(F)Oc2cc(P)c(-c3c(F)c(C)c(N(C)C(C)=O)c(F)c3F)cc21 |
| InChI | InChI=1S/C21H16F5N2O3P/c1-5-6-28-12-7-11(14(32)8-13(12)31-21(25,26)20(28)30)15-16(22)9(2)19(18(24)17(15)23)27(4)10(3)29/h1,7-8H,6,32H2,2-4H3 |
| InChIKey | TYEQSWOMWDNNQU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|