C16H16F2N2O4 — CID 170107094
1-[4-[(3S)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]pyrrolidine-3-carboxylic acid (PubChem CID 170107094) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-[4-[(3S)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-[(3S)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 170107094 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[4-[(3S)-2,6-dioxopiperidin-3-yl]-3,5-difluorophenyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C1CC[C@@H](c2c(F)cc(N3CCC(C(=O)O)C3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C16H16F2N2O4/c17-11-5-9(20-4-3-8(7-20)16(23)24)6-12(18)14(11)10-1-2-13(21)19-15(10)22/h5-6,8,10H,1-4,7H2,(H,23,24)(H,19,21,22)/t8?,10-/m0/s1 |
| InChIKey | GBOBMTABXQTYBE-HTLJXXAVSA-N |
| XLogP | 1.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|