C20H28N2O2S — CID 170107299
1-[1-(3-methylphenyl)sulfonylpiperidin-4-yl]-4-prop-2-ynylpiperidine (PubChem CID 170107299) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-[1-(3-methylphenyl)sulfonylpiperidin-4-yl]-4-prop-2-ynylpiperidine.
| Compound Name | 1-[1-(3-methylphenyl)sulfonylpiperidin-4-yl]-4-prop-2-ynylpiperidine |
|---|---|
| PubChem CID | 170107299 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-[1-(3-methylphenyl)sulfonylpiperidin-4-yl]-4-prop-2-ynylpiperidine |
| SMILES | C#CCC1CCN(C2CCN(S(=O)(=O)c3cccc(C)c3)CC2)CC1 |
| InChI | InChI=1S/C20H28N2O2S/c1-3-5-18-8-12-21(13-9-18)19-10-14-22(15-11-19)25(23,24)20-7-4-6-17(2)16-20/h1,4,6-7,16,18-19H,5,8-15H2,2H3 |
| InChIKey | GZHUDYCNGUSEBS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|