C42H76N2S2 — CID 170107335
(Z)-8-ethyl-3-[(2E,6Z)-4-ethyl-6-[(2E)-3-(4-ethyloctylamino)penta-2,4-dien-2-yl]sulfanyl-3,5-dimethylocta-2,6-dien-2-yl]sulfanyl-5-methylidenedodec-3-en-4-amine (PubChem CID 170107335) has the molecular formula C42H76N2S2 and a molecular weight of 673.22 g/mol. Its IUPAC name is (Z)-8-ethyl-3-[(2E,6Z)-4-ethyl-6-[(2E)-3-(4-ethyloctylamino)penta-2,4-dien-2-yl]sulfanyl-3,5-dimethylocta-2,6-dien-2-yl]sulfanyl-5-methylidenedodec-3-en-4-amine.
| Compound Name | (Z)-8-ethyl-3-[(2E,6Z)-4-ethyl-6-[(2E)-3-(4-ethyloctylamino)penta-2,4-dien-2-yl]sulfanyl-3,5-dimethylocta-2,6-dien-2-yl]sulfanyl-5-methylidenedodec-3-en-4-amine |
|---|---|
| PubChem CID | 170107335 |
| Molecular Formula | C42H76N2S2 |
| Molecular Weight | 673.22 g/mol |
| Exact Mass | 672.54 |
| IUPAC Name | (Z)-8-ethyl-3-[(2E,6Z)-4-ethyl-6-[(2E)-3-(4-ethyloctylamino)penta-2,4-dien-2-yl]sulfanyl-3,5-dimethylocta-2,6-dien-2-yl]sulfanyl-5-methylidenedodec-3-en-4-amine |
| SMILES | C=C/C(NCCCC(CC)CCCC)=C(/C)S/C(=C\C)C(C)C(CC)/C(C)=C(\C)S/C(CC)=C(\N)C(=C)CCC(CC)CCCC |
| InChI | InChI=1S/C42H76N2S2/c1-14-22-25-36(16-3)27-24-30-44-39(19-6)35(13)46-40(20-7)33(11)38(18-5)32(10)34(12)45-41(21-8)42(43)31(9)28-29-37(17-4)26-23-15-2/h19-20,33,36-38,44H,6,9,14-18,21-30,43H2,1-5,7-8,10-13H3/b34-32+,39-35+,40-20-,42-41- |
| InChIKey | VNWRRRBQLRVCJL-OCFCRGETSA-N |
| XLogP | 14.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.22 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|