C9H17N3 — CID 170107411
(2E)-4-imino-1-N,2-dimethylhepta-2,6-diene-1,6-diamine (PubChem CID 170107411) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (2E)-4-imino-1-N,2-dimethylhepta-2,6-diene-1,6-diamine.
| Compound Name | (2E)-4-imino-1-N,2-dimethylhepta-2,6-diene-1,6-diamine |
|---|---|
| PubChem CID | 170107411 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (2E)-4-imino-1-N,2-dimethylhepta-2,6-diene-1,6-diamine |
| SMILES | [H]/N=C(/C=C(\C)CNC)CC(=C)N |
| InChI | InChI=1S/C9H17N3/c1-7(6-12-3)4-9(11)5-8(2)10/h4,11-12H,2,5-6,10H2,1,3H3/b7-4+,11-9- |
| InChIKey | LPQPDMZOIXXXJX-DHIFYFQBSA-N |
| XLogP | 1.03 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|